Synthesis, Crystal Structure and Luminescenceof a Novel Metal-Organic Polymer{Cd2(C4H2O4)2(C4H6N2)2(H2O)2· 2H2O}_n

摘要

The novel 3D coordination polymer {Cd2(C4H2O4)2(C4H6N2)2(H2O)2 · 2H2O}_n (I) has been synthesized and characterized by standard solid state methods including single-crystal X-ray crystallography. The compound crystallizes in triclinic space groupP1 with a = 8.589(4), b = 10.585(3), c = 13.094(1) A, α = 84.91(4)°, β = 79.21(0)°, γ = 83.76(4)°, V= 1159.5(1) A~3, Z= 2. The fumaric acid acts as a multimodal bridging ligand in the polymer unit. One of the fumaric acid ligands tridentately chelates to two Cd~(2+) cations in the same dinuclear unit, while the other bidentately chelates to two Cd~(2+) cations in another dinuclear unit. The two metal centers possess slightly distorted pentagonal bipyramid geometry with four Cd {(μ4-fuma-rato)-(μ2-fumarato)-bis(2-methylimidazolyl)-diaqua} units joining together to form a 28-membered ring. The whole molecule exhibits a through channel along γ-axis and 2D layers in xz plane. With hydrogen bond and π-π interaction, the 2D layers construct a 3D microporous network.