9-silyl(germyl,stannyl) substituted derivatives of 1-(9-fluorenyl)germatranes. Synthesis, characterisation, and crystal structures

摘要

9-Trimethylsilyl- and 9-trimethylgermyl substituted derivatives of 1-(9-fluorenyl)germatranes C13H8(R)Ge(OCH2CH2)(3)N (1 - 3) (1: R = H; 2: R = Me3Si; 3: R = Me3Ge) were prepared by the reaction of 9-tribromogermyl derivatives of fluorene C13H8(R)GeBr3 (4 - 6) with N(CH(2)CH(2)OSnAlk(3))(3) (7: Alk = Et; 8: Alk = Bu). 1-(9-Trimethylstannyl-9-fluorenyl)germatrane (14) was synthesised by the reaction of the germatrane (1) with Me3SnNMe2. Formulas and structures were established by elemental analyses, (H-1, C-13) NMR spectroscopy and mass spectrometry; crystal structures of 2 and 14 are reported. [References: 33]