Acrylic copolymer elastomer, blended rubber thereof and blended rubber composition

摘要

A copolymer comprising an alkyl acrylate and an unsaturated ester compound represented by the following general formula: CH2=CRCOO(CH2)nPhOR', CH2=CRCOO(CH2)nOCO(CH2)mPhOR', CH2=CHOCO(CH2)nOCO(CH2)mPhOR', CH2=CHO(CH2)nOCO(CH2)mPhOR' or CH2=CHPh(CH2)nOCO(CH2)mPhOR' where R is a hydrogen atom or a methyl group; R' is a hydrogen atom, an acyl group or a trialkylsilyl group; and Ph is a phenylene group, forms a blend rubber having a good heat resistance and a good amine resistance with a fluorine-containing elastomer.