X-ray Crystallographic Studies of a Bimetallicrncis-Mo(CO)4(PPh2NH2CH2CH2N=CHC6H4-o-O)2Cu Complex,rnthe Starting Material, cis-Mo(CO)4(PPh2Cl)2, and the ReactionrnIntermediates cis-Mo(CO)4(PPh2NH2CH2CH2NH2)2rnand cis-Mo(CO)4(PPh2NH2CH2CH2N=CHC6H4-o-OH)2

摘要

Abstract In this paper, we report the crystal structures of a bimetallic trans-[cis-Mo(CO)₄[PPh₂NHCH₂CH₂N=CH(o-C₆H₄O)]₂]Cu complex (monoclinic space group P2/c), the cis-Mo(CO)₄(PPh₂Cl)₂ starting material, (monoclinic space group C2/c) and the two reaction intermediates cis-Mo(CO)₄(PPh₂NHCH₂CH₂NH₂)₂ (monoclinic space group C2/c) and cis-Mo(CO)₄(PPh₂NHCH₂CH₂N=CH(o-C₆H₄OH)₂ (orthorhombic space group P2(1)2(1)2). The dihedral angle between the o-salicylaldiminato groups in the bimetallic complex (36.32(18)°) is considerable large than that in the previously reported trans-[cis-Mo(CO)_4-[PPh₂NHCH₂CH₂N=CH(o-C₆H₄O)]₂]Ni complex (12.6°) demonstrating that the coordination preferences of the metal dications have significant effects on the conformations of the bimetallic complexes. The orientations of the phosphinamide ligands bimetallic complex are quite different than are those in the intermediates due to the steric restraints imposed by chelation to the Cu2+.