Hydrothermal Synthesis, Crystal Structure and Electrochemical Properties of the Copper(Ⅱ) Complex Cu4O4(phen)4(ClC6H4COO)2(H2O)2·(H2O)3

摘要

The title complex of copper(Ⅱ) with m-chlorobenzoic acid, 1,10-phenanthroline (phen) and copper perchlorate has been synthesized and characterized in the solvent mixture of water and methanol. Crystal data for this complex: triclinic, space group P, a = 1.06853(12), b = 1.30740(16), c = 1.49546(17) nm, α = 101.791(2), β = 103.413(2), γ = 105.815(2)o, V = 1.8736(4) nm3, Mr = 904.67, Dc = 1.604 g/cm3, Z = 2, F(000) = 924, μ = 1.34 mm-1, GOOF = 1.049, the final R = 0.0324 and wR = 0.0797. The structure analysis shows that a chair-like structure [Cu4O4] is defined by three quadrilaterals shaped by four copper and four oxygen atoms, and every copper ion is coordinated by three oxygen atoms from three water molecules and two nitrogen atoms from one 1,10-phenanthroline molecule, giving a distorted square-pyramidal coordination geometry. The CV analysis results indicate that the electron transfer in the electrode reaction is quasi-reversible.