Ferrocenyl-substituted imine ligands and their reactivity towards Fe-2(CO)(9); crystal structure of Fc-C(H)=C(H)-C(H)=N-C6H11 and (eta(4)-R-1-C(H)=C(H)-C(H)=N-R-2)Fe(CO)(3) (R-1 = C6H5, R-2 = Fc; R-1 = Fc, R-2 = C6H11, R-1 = R-2 = Fc; Fc = (eta(5)-C5

摘要

The synthesis of l-azadiene Ligands bearing ferrocenyl groups either at the C- or N-terminus or on both sides of the ligand from alpha,beta-unsaturated aldehydes and the corresponding amine is described. The reaction of these imine ligands with Fe-2(CO)(9) produces mononuclear iron complexes of the general formula (eta(4)-1-azadiene) Fe(CO)(3). The molecular structure of one of the I-azadiene ligands as well as those of three iron complexes were determined by X-ray structure analyses. (C) 1998 Elsevier Science S.A. All rights reserved. [References: 39]