Synthesis and properties of carbosilane dendrimers with perfluorohexyl groups in the outer layer of the molecular structure

摘要

Branched perfluorohydrosiloxane with CF3CF2CF2C(CF3)(2)(CH2)(3) groups at the silicon atom was synthesized by a sequence of chemical reactions. The resulting compound was used as a modifying agent for carbosilane dendrimers of the 3rd and 6th generations. Dendrimers with perfluorohexyl terminal groups in surface layer are characterized by a complex of physicochemical methods. It is demonstrated that due to the branching of perfluoroalkyl terminal groups, obtained carbosilane dendrimers are soluble in organic and inorganic media. Differences in the solubility of small and large dendrimers are caused by the formation of the outer fluoride shell of different densities.