Transition metal chemistry of phosphorus based ligands: synthesis and transition metal chemistry of N,N '-dimethyl,-bis(diphenylphosphino)ethylenediamine. The crystal and molecular structure of [ReBr(CO)(3){Ph2PN(Me)CH2CH2(Me)NPPh2}]

摘要

The bis(phosphine), Ph2PN(CH3)CH2CH2N(CH3)PPh2 reacts with Group 6 metal carbonyl derivatives, [ReBr(CO)(3)(NCMe)(2)] and [MCl2(COD)] (M = Pd or Pt) to give the corresponding seven-membered chelate complexes. The compounds have been characterized by elemental analysis, IR and NMR spectroscopic data. The structure of the rhenium complex, [ReBr(CO)(3){Ph2PN(CH3)CH2CH2(CH3)NPPh2}] has been confirmed by X-ray crystallography. (C) 2001 Elsevier Science B.V. AU rights reserved. [References: 29]