A deliberate approach for the syntheses of heterometallic supramolecules containing dimolybdenum Mo-2(4+) species coordinated to other metal units

摘要

Two compounds with quadruply bonded Mo-2(4+) species having isonicotinate ligands bound through the carboxylate group have been designed to act as anglers by luring metal-containing Lewis acids to bind to the N-pyridyl group. The corner pieces are Mo-2(DAniF)(3)(O2CC5H4N) (1) and cis-Mo-2(DAniF)(2)(O2CC5H4N)(2) (2), DAniF = N,N'-di(p-anisyl)formamidinate. The heterometallic molecular rods 1-Ni(acac)(2)-1 (3) and 1-Rh-2(O2CCH3)(4)-1 (4) were made by reaction of 1 with Ni(acac)(2) and the metal-metal bonded species Rh-2(O2CCH3)(4), respectively. In these compounds either a mononuclear or a dinuclear species are sandwiched between two molecules of 1. The cisoid compound 2 has been employed for the synthesis of a molecular rhombus, [2-Zn(Cl-2)](2) (5). The successful syntheses and isolation of 3-5 show that the use of corner pieces with angler groups is an excellent approach for making heterometallic supramolecular compounds having a combination of metal-metal bonded units and other metal species.